Blog

How many degrees of unsaturation are represented by an alkyne?

In the following multi-step synthesis: Describe the reaction that happens in step 1.  Explain or name the product in the middle box.   Describe the reaction that happens in step 2.  Propose the IUPAC name of the final product.        

Label each indicated alkene as E or Z in Claravis, a vitamin A derivative used to treat severe acne.

Choose the major product(s) of the following reaction.   

Which descriptor best fits the site indicated by an arrow below?  

Which of the following alkenes is an E alkene? Choose all that apply.  

Label each indicated alkene as E or Z in the molecule below.

Match the reaction to the best name for it.

The intermediate for the mechanism for the halogenation reaction shown should be [intermediate] leading to [stereo] stereoselectivity for the product.

Answer the following questions with complete explanations of your reasoning for each.  Which of the following fatty acids is most likely to be solid at room temperature?  Which of the fatty acids above would turn orange last upon addition of bromine?  CH3(CH2)4(CH=CH)CH2(CH=CH)(CH2)7COOH CH3(CH2)18COOH CH3(CH2)7CH=CH(CH2)6COOH CH3(CH2)16COOH